C21H29NO4S — CID 71231578
4-(hydroxymethyl)-N-[(2S)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 71231578) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[(2S)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-(hydroxymethyl)-N-[(2S)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71231578 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-(hydroxymethyl)-N-[(2S)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(C[C@@H](O)CCc1ccccc1)S(=O)(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C21H29NO4S/c1-17(2)14-22(15-20(24)11-8-18-6-4-3-5-7-18)27(25,26)21-12-9-19(16-23)10-13-21/h3-7,9-10,12-13,17,20,23-24H,8,11,14-16H2,1-2H3/t20-/m0/s1 |
| InChIKey | YPFMWGKUMINERE-FQEVSTJZSA-N |
| XLogP | 2.82 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |