C27H30N4O5S — CID 18337563
(2R)-2-[3H-benzimidazol-5-ylmethyl-(4-methoxyphenyl)sulfonylamino]-3-methyl-N-phenylmethoxybutanamide (PubChem CID 18337563) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is (2R)-2-[3H-benzimidazol-5-ylmethyl-(4-methoxyphenyl)sulfonylamino]-3-methyl-N-phenylmethoxybutanamide.
| Compound Name | (2R)-2-[3H-benzimidazol-5-ylmethyl-(4-methoxyphenyl)sulfonylamino]-3-methyl-N-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 18337563 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (2R)-2-[3H-benzimidazol-5-ylmethyl-(4-methoxyphenyl)sulfonylamino]-3-methyl-N-phenylmethoxybutanamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccc3nc[nH]c3c2)[C@@H](C(=O)NOCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-19(2)26(27(32)30-36-17-20-7-5-4-6-8-20)31(16-21-9-14-24-25(15-21)29-18-28-24)37(33,34)23-12-10-22(35-3)11-13-23/h4-15,18-19,26H,16-17H2,1-3H3,(H,28,29)(H,30,32)/t26-/m1/s1 |
| InChIKey | OVJMCWFMKMFEHK-AREMUKBSSA-N |
| XLogP | 4.03 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|