C20H23N3O5S — CID 18337561
(2R)-2-[3H-benzimidazol-5-ylmethyl-(4-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 18337561) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is (2R)-2-[3H-benzimidazol-5-ylmethyl-(4-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[3H-benzimidazol-5-ylmethyl-(4-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18337561 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (2R)-2-[3H-benzimidazol-5-ylmethyl-(4-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccc3nc[nH]c3c2)[C@@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C20H23N3O5S/c1-13(2)19(20(24)25)23(11-14-4-9-17-18(10-14)22-12-21-17)29(26,27)16-7-5-15(28-3)6-8-16/h4-10,12-13,19H,11H2,1-3H3,(H,21,22)(H,24,25)/t19-/m1/s1 |
| InChIKey | WJKMOHPIYMADBJ-LJQANCHMSA-N |
| XLogP | 2.87 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |