C27H30N4O5S — CID 57197479
(2R)-2-[[2-(3H-benzimidazol-5-ylmethyl)-4-methoxyphenyl]sulfonylamino]-3-methyl-N-phenylmethoxybutanamide (PubChem CID 57197479) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is (2R)-2-[[2-(3H-benzimidazol-5-ylmethyl)-4-methoxyphenyl]sulfonylamino]-3-methyl-N-phenylmethoxybutanamide.
| Compound Name | (2R)-2-[[2-(3H-benzimidazol-5-ylmethyl)-4-methoxyphenyl]sulfonylamino]-3-methyl-N-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 57197479 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (2R)-2-[[2-(3H-benzimidazol-5-ylmethyl)-4-methoxyphenyl]sulfonylamino]-3-methyl-N-phenylmethoxybutanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C(=O)NOCc2ccccc2)C(C)C)c(Cc2ccc3nc[nH]c3c2)c1 |
| InChI | InChI=1S/C27H30N4O5S/c1-18(2)26(27(32)30-36-16-19-7-5-4-6-8-19)31-37(33,34)25-12-10-22(35-3)15-21(25)13-20-9-11-23-24(14-20)29-17-28-23/h4-12,14-15,17-18,26,31H,13,16H2,1-3H3,(H,28,29)(H,30,32)/t26-/m1/s1 |
| InChIKey | RJSJXUQXKZDOEV-AREMUKBSSA-N |
| XLogP | 3.71 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|