C27H33N3O7S — CID 22859996
(2R)-N-[(2,4-dimethoxyphenyl)methoxy]-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide (PubChem CID 22859996) has the molecular formula C27H33N3O7S and a molecular weight of 543.64 g/mol. Its IUPAC name is (2R)-N-[(2,4-dimethoxyphenyl)methoxy]-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide.
| Compound Name | (2R)-N-[(2,4-dimethoxyphenyl)methoxy]-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 22859996 |
| Molecular Formula | C27H33N3O7S |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | (2R)-N-[(2,4-dimethoxyphenyl)methoxy]-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)[C@@H](C(=O)NOCc2ccc(OC)cc2OC)C(C)C)cc1 |
| InChI | InChI=1S/C27H33N3O7S/c1-19(2)26(27(31)29-37-18-21-8-9-23(35-4)15-25(21)36-5)30(17-20-7-6-14-28-16-20)38(32,33)24-12-10-22(34-3)11-13-24/h6-16,19,26H,17-18H2,1-5H3,(H,29,31)/t26-/m1/s1 |
| InChIKey | ZJCHMRUPSJNZIJ-AREMUKBSSA-N |
| XLogP | 3.57 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|