C21H30N2O4S — CID 76747684
N-hydroxy-3-methyl-2-[3-methylbutyl-(7-methylnaphthalen-2-yl)sulfonylamino]butanamide (PubChem CID 76747684) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-hydroxy-3-methyl-2-[3-methylbutyl-(7-methylnaphthalen-2-yl)sulfonylamino]butanamide.
| Compound Name | N-hydroxy-3-methyl-2-[3-methylbutyl-(7-methylnaphthalen-2-yl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 76747684 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-hydroxy-3-methyl-2-[3-methylbutyl-(7-methylnaphthalen-2-yl)sulfonylamino]butanamide |
| SMILES | Cc1ccc2ccc(S(=O)(=O)N(CCC(C)C)C(C(=O)NO)C(C)C)cc2c1 |
| InChI | InChI=1S/C21H30N2O4S/c1-14(2)10-11-23(20(15(3)4)21(24)22-25)28(26,27)19-9-8-17-7-6-16(5)12-18(17)13-19/h6-9,12-15,20,25H,10-11H2,1-5H3,(H,22,24) |
| InChIKey | IQUBLFNZZFSPSH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|