C18H25N3O4S — CID 143926014
(2R)-2-[(7-aminonaphthalen-2-yl)sulfonyl-(3-methylbutyl)amino]-N-hydroxypropanamide (PubChem CID 143926014) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is (2R)-2-[(7-aminonaphthalen-2-yl)sulfonyl-(3-methylbutyl)amino]-N-hydroxypropanamide.
| Compound Name | (2R)-2-[(7-aminonaphthalen-2-yl)sulfonyl-(3-methylbutyl)amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 143926014 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (2R)-2-[(7-aminonaphthalen-2-yl)sulfonyl-(3-methylbutyl)amino]-N-hydroxypropanamide |
| SMILES | CC(C)CCN([C@H](C)C(=O)NO)S(=O)(=O)c1ccc2ccc(N)cc2c1 |
| InChI | InChI=1S/C18H25N3O4S/c1-12(2)8-9-21(13(3)18(22)20-23)26(24,25)17-7-5-14-4-6-16(19)10-15(14)11-17/h4-7,10-13,23H,8-9,19H2,1-3H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | CVBRNMBGVCXUDQ-CYBMUJFWSA-N |
| XLogP | 2.35 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|