C16H27ClFN3O4S — CID 122196492
(2R)-2-[6-aminohexyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide;hydrochloride (PubChem CID 122196492) has the molecular formula C16H27ClFN3O4S and a molecular weight of 411.93 g/mol. Its IUPAC name is (2R)-2-[6-aminohexyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide;hydrochloride.
| Compound Name | (2R)-2-[6-aminohexyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 122196492 |
| Molecular Formula | C16H27ClFN3O4S |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (2R)-2-[6-aminohexyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)N(CCCCCCN)[C@H](C)C(=O)NO)ccc1F.Cl |
| InChI | InChI=1S/C16H26FN3O4S.ClH/c1-12-11-14(7-8-15(12)17)25(23,24)20(13(2)16(21)19-22)10-6-4-3-5-9-18;/h7-8,11,13,22H,3-6,9-10,18H2,1-2H3,(H,19,21);1H/t13-;/m1./s1 |
| InChIKey | SXUMWYXTEPKUSO-BTQNPOSSSA-N |
| XLogP | 1.96 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|