C13H20FN3O4S — CID 122196499
(2R)-2-[3-aminopropyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide (PubChem CID 122196499) has the molecular formula C13H20FN3O4S and a molecular weight of 333.38 g/mol. Its IUPAC name is (2R)-2-[3-aminopropyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide.
| Compound Name | (2R)-2-[3-aminopropyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 122196499 |
| Molecular Formula | C13H20FN3O4S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2R)-2-[3-aminopropyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide |
| SMILES | Cc1cc(S(=O)(=O)N(CCCN)[C@H](C)C(=O)NO)ccc1F |
| InChI | InChI=1S/C13H20FN3O4S/c1-9-8-11(4-5-12(9)14)22(20,21)17(7-3-6-15)10(2)13(18)16-19/h4-5,8,10,19H,3,6-7,15H2,1-2H3,(H,16,18)/t10-/m1/s1 |
| InChIKey | VYBYDPHFTQUSHN-SNVBAGLBSA-N |
| XLogP | 0.37 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|