C20H24FN3O5S — CID 122196501
(2R)-2-[[4-(acetamidomethyl)phenyl]methyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide (PubChem CID 122196501) has the molecular formula C20H24FN3O5S and a molecular weight of 437.49 g/mol. Its IUPAC name is (2R)-2-[[4-(acetamidomethyl)phenyl]methyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide.
| Compound Name | (2R)-2-[[4-(acetamidomethyl)phenyl]methyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 122196501 |
| Molecular Formula | C20H24FN3O5S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (2R)-2-[[4-(acetamidomethyl)phenyl]methyl-(4-fluoro-3-methylphenyl)sulfonylamino]-N-hydroxypropanamide |
| SMILES | CC(=O)NCc1ccc(CN([C@H](C)C(=O)NO)S(=O)(=O)c2ccc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C20H24FN3O5S/c1-13-10-18(8-9-19(13)21)30(28,29)24(14(2)20(26)23-27)12-17-6-4-16(5-7-17)11-22-15(3)25/h4-10,14,27H,11-12H2,1-3H3,(H,22,25)(H,23,26)/t14-/m1/s1 |
| InChIKey | GYWYTQPIZBRUSZ-CQSZACIVSA-N |
| XLogP | 1.86 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|