C17H27BrN2O4S — CID 24759242
(2R)-2-[(3-bromophenyl)sulfonyl-(3-methylbutyl)amino]-N-hydroxy-3,3-dimethylbutanamide (PubChem CID 24759242) has the molecular formula C17H27BrN2O4S and a molecular weight of 435.38 g/mol. Its IUPAC name is (2R)-2-[(3-bromophenyl)sulfonyl-(3-methylbutyl)amino]-N-hydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-[(3-bromophenyl)sulfonyl-(3-methylbutyl)amino]-N-hydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 24759242 |
| Molecular Formula | C17H27BrN2O4S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (2R)-2-[(3-bromophenyl)sulfonyl-(3-methylbutyl)amino]-N-hydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)CCN([C@@H](C(=O)NO)C(C)(C)C)S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H27BrN2O4S/c1-12(2)9-10-20(15(16(21)19-22)17(3,4)5)25(23,24)14-8-6-7-13(18)11-14/h6-8,11-12,15,22H,9-10H2,1-5H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | FSLZREYQJOLUJT-HNNXBMFYSA-N |
| XLogP | 3.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|