C19H31N2O5STl — CID 143559386
(2R)-2-[(3-methoxyphenyl)sulfonyl-(3-methylbutyl)amino]-3,3-dimethyl-N-methylidenethallanyloxybutanamide (PubChem CID 143559386) has the molecular formula C19H31N2O5STl and a molecular weight of 603.92 g/mol. Its IUPAC name is (2R)-2-[(3-methoxyphenyl)sulfonyl-(3-methylbutyl)amino]-3,3-dimethyl-N-methylidenethallanyloxybutanamide.
| Compound Name | (2R)-2-[(3-methoxyphenyl)sulfonyl-(3-methylbutyl)amino]-3,3-dimethyl-N-methylidenethallanyloxybutanamide |
|---|---|
| PubChem CID | 143559386 |
| Molecular Formula | C19H31N2O5STl |
| Molecular Weight | 603.92 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | (2R)-2-[(3-methoxyphenyl)sulfonyl-(3-methylbutyl)amino]-3,3-dimethyl-N-methylidenethallanyloxybutanamide |
| SMILES | C=[Tl]ONC(=O)[C@H](N(CCC(C)C)S(=O)(=O)c1cccc(OC)c1)C(C)(C)C |
| InChI | InChI=1S/C18H29N2O5S.CH2.Tl/c1-13(2)10-11-20(16(17(21)19-22)18(3,4)5)26(23,24)15-9-7-8-14(12-15)25-6;;/h7-9,12-13,16H,10-11H2,1-6H3,(H-,19,21,22);1H2;/q-1;;+1/t16-;;/m0../s1 |
| InChIKey | ADRNKADQBGVASX-SQKCAUCHSA-N |
| XLogP | 2.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.92 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|