About benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate
benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate (PubChem CID 69001271) has the molecular formula C28H34N2O5S
and a molecular weight of 510.66 g/mol. Its IUPAC name is benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate |
| PubChem CID | 69001271 |
| Molecular Formula | C28H34N2O5S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate |
| SMILES | COc1cccc(S(=O)(=O)N(CCCc2cccnc2)C(C(=O)OCc2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H34N2O5S/c1-28(2,3)26(27(31)35-21-23-11-6-5-7-12-23)30(18-10-14-22-13-9-17-29-20-22)36(32,33)25-16-8-15-24(19-25)34-4/h5-9,11-13,15-17,19-20,26H,10,14,18,21H2,1-4H3 |
| InChIKey | LNSYVKZKAHLYEU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate?
The IUPAC name of benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate (CID 69001271) is benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate.
What is the SMILES notation for benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate?
The canonical SMILES for benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate is COc1cccc(S(=O)(=O)N(CCCc2cccnc2)C(C(=O)OCc2ccccc2)C(C)(C)C)c1.
What is the InChIKey of benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate?
The InChIKey is LNSYVKZKAHLYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O5S/c1-28(2,3)26(27(31)35-21-23-11-6-5-7-12-23)30(18-10-14-22-13-9-17-29-20-22)36(32,33)25-16-8-15-24(19-25)34-4/h5-9,11-13,15-17,19-20,26H,10,14,18,21H2,1-4H3.
What are the key properties of benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate?
benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate has a molecular weight of 510.66 g/mol, XLogP of 4.87, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(3-methoxyphenyl)sulfonyl-(3-pyridin-3-ylpropyl)amino]-3,3-dimethylbutanoate is sourced from PubChem (CID 69001271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).