C20H28N2O5S — CID 57394732
(2R)-N-hydroxy-2-[(7-hydroxynaphthalen-2-yl)sulfonyl-(3-methylbutyl)amino]-3-methylbutanamide (PubChem CID 57394732) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is (2R)-N-hydroxy-2-[(7-hydroxynaphthalen-2-yl)sulfonyl-(3-methylbutyl)amino]-3-methylbutanamide.
| Compound Name | (2R)-N-hydroxy-2-[(7-hydroxynaphthalen-2-yl)sulfonyl-(3-methylbutyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 57394732 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (2R)-N-hydroxy-2-[(7-hydroxynaphthalen-2-yl)sulfonyl-(3-methylbutyl)amino]-3-methylbutanamide |
| SMILES | CC(C)CCN([C@@H](C(=O)NO)C(C)C)S(=O)(=O)c1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C20H28N2O5S/c1-13(2)9-10-22(19(14(3)4)20(24)21-25)28(26,27)18-8-6-15-5-7-17(23)11-16(15)12-18/h5-8,11-14,19,23,25H,9-10H2,1-4H3,(H,21,24)/t19-/m1/s1 |
| InChIKey | MDDFFAOYZXGICC-LJQANCHMSA-N |
| XLogP | 3.11 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|