C24H27ClN2O3S — CID 143925983
(2R)-2-[2-(4-chlorophenoxy)ethyl-naphthalen-2-ylsulfanylamino]-N-hydroxy-3,3-dimethylbutanamide (PubChem CID 143925983) has the molecular formula C24H27ClN2O3S and a molecular weight of 459.01 g/mol. Its IUPAC name is (2R)-2-[2-(4-chlorophenoxy)ethyl-naphthalen-2-ylsulfanylamino]-N-hydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-[2-(4-chlorophenoxy)ethyl-naphthalen-2-ylsulfanylamino]-N-hydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 143925983 |
| Molecular Formula | C24H27ClN2O3S |
| Molecular Weight | 459.01 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (2R)-2-[2-(4-chlorophenoxy)ethyl-naphthalen-2-ylsulfanylamino]-N-hydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](C(=O)NO)N(CCOc1ccc(Cl)cc1)Sc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H27ClN2O3S/c1-24(2,3)22(23(28)26-29)27(14-15-30-20-11-9-19(25)10-12-20)31-21-13-8-17-6-4-5-7-18(17)16-21/h4-13,16,22,29H,14-15H2,1-3H3,(H,26,28)/t22-/m0/s1 |
| InChIKey | DLBUMQOBQGINEC-QFIPXVFZSA-N |
| XLogP | 5.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.01 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|