C15H22ClNO5S — CID 21259088
2-[[2-(4-chlorophenoxy)ethyl-methylsulfamoyl]methyl]-3-methylbutanoic acid (PubChem CID 21259088) has the molecular formula C15H22ClNO5S and a molecular weight of 363.86 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenoxy)ethyl-methylsulfamoyl]methyl]-3-methylbutanoic acid.
| Compound Name | 2-[[2-(4-chlorophenoxy)ethyl-methylsulfamoyl]methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 21259088 |
| Molecular Formula | C15H22ClNO5S |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[[2-(4-chlorophenoxy)ethyl-methylsulfamoyl]methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CS(=O)(=O)N(C)CCOc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H22ClNO5S/c1-11(2)14(15(18)19)10-23(20,21)17(3)8-9-22-13-6-4-12(16)5-7-13/h4-7,11,14H,8-10H2,1-3H3,(H,18,19) |
| InChIKey | UTBOESQRBJAPKA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |