C17H18ClNO5S — CID 14917015
3-[3-[(4-chlorophenyl)sulfonyl-methylamino]propoxy]benzoic acid (PubChem CID 14917015) has the molecular formula C17H18ClNO5S and a molecular weight of 383.85 g/mol. Its IUPAC name is 3-[3-[(4-chlorophenyl)sulfonyl-methylamino]propoxy]benzoic acid.
| Compound Name | 3-[3-[(4-chlorophenyl)sulfonyl-methylamino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 14917015 |
| Molecular Formula | C17H18ClNO5S |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 3-[3-[(4-chlorophenyl)sulfonyl-methylamino]propoxy]benzoic acid |
| SMILES | CN(CCCOc1cccc(C(=O)O)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO5S/c1-19(25(22,23)16-8-6-14(18)7-9-16)10-3-11-24-15-5-2-4-13(12-15)17(20)21/h2,4-9,12H,3,10-11H2,1H3,(H,20,21) |
| InChIKey | LGCKQBVMVHWICN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|