C15H21ClO5S — CID 18533148
2-[3-(4-chlorophenoxy)propylsulfonylmethyl]-3-methylbutanoic acid (PubChem CID 18533148) has the molecular formula C15H21ClO5S and a molecular weight of 348.85 g/mol. Its IUPAC name is 2-[3-(4-chlorophenoxy)propylsulfonylmethyl]-3-methylbutanoic acid.
| Compound Name | 2-[3-(4-chlorophenoxy)propylsulfonylmethyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18533148 |
| Molecular Formula | C15H21ClO5S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-[3-(4-chlorophenoxy)propylsulfonylmethyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CS(=O)(=O)CCCOc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H21ClO5S/c1-11(2)14(15(17)18)10-22(19,20)9-3-8-21-13-6-4-12(16)5-7-13/h4-7,11,14H,3,8-10H2,1-2H3,(H,17,18) |
| InChIKey | GAZFJBZLJUWBHG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|