C21H32O5S — CID 18533046
3-methyl-2-[3-(4-phenylcyclohexyl)oxypropylsulfonylmethyl]butanoic acid (PubChem CID 18533046) has the molecular formula C21H32O5S and a molecular weight of 396.55 g/mol. Its IUPAC name is 3-methyl-2-[3-(4-phenylcyclohexyl)oxypropylsulfonylmethyl]butanoic acid.
| Compound Name | 3-methyl-2-[3-(4-phenylcyclohexyl)oxypropylsulfonylmethyl]butanoic acid |
|---|---|
| PubChem CID | 18533046 |
| Molecular Formula | C21H32O5S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-methyl-2-[3-(4-phenylcyclohexyl)oxypropylsulfonylmethyl]butanoic acid |
| SMILES | CC(C)C(CS(=O)(=O)CCCOC1CCC(c2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C21H32O5S/c1-16(2)20(21(22)23)15-27(24,25)14-6-13-26-19-11-9-18(10-12-19)17-7-4-3-5-8-17/h3-5,7-8,16,18-20H,6,9-15H2,1-2H3,(H,22,23) |
| InChIKey | SAYOTOLYIODNNU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|