C23H34N2O3S — CID 143925967
(2R)-N-hydroxy-3-methyl-2-[3-methylbutyl-(6-propoxynaphthalen-2-yl)sulfanylamino]butanamide (PubChem CID 143925967) has the molecular formula C23H34N2O3S and a molecular weight of 418.60 g/mol. Its IUPAC name is (2R)-N-hydroxy-3-methyl-2-[3-methylbutyl-(6-propoxynaphthalen-2-yl)sulfanylamino]butanamide.
| Compound Name | (2R)-N-hydroxy-3-methyl-2-[3-methylbutyl-(6-propoxynaphthalen-2-yl)sulfanylamino]butanamide |
|---|---|
| PubChem CID | 143925967 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (2R)-N-hydroxy-3-methyl-2-[3-methylbutyl-(6-propoxynaphthalen-2-yl)sulfanylamino]butanamide |
| SMILES | CCCOc1ccc2cc(SN(CCC(C)C)[C@@H](C(=O)NO)C(C)C)ccc2c1 |
| InChI | InChI=1S/C23H34N2O3S/c1-6-13-28-20-9-7-19-15-21(10-8-18(19)14-20)29-25(12-11-16(2)3)22(17(4)5)23(26)24-27/h7-10,14-17,22,27H,6,11-13H2,1-5H3,(H,24,26)/t22-/m1/s1 |
| InChIKey | NIPFLIITXMQUOS-JOCHJYFZSA-N |
| XLogP | 5.51 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|