C26H37NO6S2 — CID 158933985
ethyl 2-(4-methoxyphenyl)sulfanyl-3-methylbutanoate;N-hydroxy-2-(4-methoxyphenyl)sulfanyl-3-methylbutanamide (PubChem CID 158933985) has the molecular formula C26H37NO6S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is ethyl 2-(4-methoxyphenyl)sulfanyl-3-methylbutanoate;N-hydroxy-2-(4-methoxyphenyl)sulfanyl-3-methylbutanamide.
| Compound Name | ethyl 2-(4-methoxyphenyl)sulfanyl-3-methylbutanoate;N-hydroxy-2-(4-methoxyphenyl)sulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 158933985 |
| Molecular Formula | C26H37NO6S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)sulfanyl-3-methylbutanoate;N-hydroxy-2-(4-methoxyphenyl)sulfanyl-3-methylbutanamide |
| SMILES | CCOC(=O)C(Sc1ccc(OC)cc1)C(C)C.COc1ccc(SC(C(=O)NO)C(C)C)cc1 |
| InChI | InChI=1S/C14H20O3S.C12H17NO3S/c1-5-17-14(15)13(10(2)3)18-12-8-6-11(16-4)7-9-12;1-8(2)11(12(14)13-15)17-10-6-4-9(16-3)5-7-10/h6-10,13H,5H2,1-4H3;4-8,11,15H,1-3H3,(H,13,14) |
| InChIKey | JJKPXRKJDCHKCX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|