C21H16Cl2N2O5S — CID 19211287
2-chloro-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-5-nitrobenzamide (PubChem CID 19211287) has the molecular formula C21H16Cl2N2O5S and a molecular weight of 479.34 g/mol. Its IUPAC name is 2-chloro-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-5-nitrobenzamide.
| Compound Name | 2-chloro-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 19211287 |
| Molecular Formula | C21H16Cl2N2O5S |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 2-chloro-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-5-nitrobenzamide |
| SMILES | Cc1ccc(C)c(N(C(=O)c2cc([N+](=O)[O-])ccc2Cl)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H16Cl2N2O5S/c1-13-3-4-14(2)20(11-13)24(31(29,30)17-8-5-15(22)6-9-17)21(26)18-12-16(25(27)28)7-10-19(18)23/h3-12H,1-2H3 |
| InChIKey | WPBFMRRUGDTKFP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|