C24H22Cl3NO4S — CID 19218656
N-(4-chlorophenyl)sulfonyl-4-(2,4-dichlorophenoxy)-N-(2,5-dimethylphenyl)butanamide (PubChem CID 19218656) has the molecular formula C24H22Cl3NO4S and a molecular weight of 526.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-4-(2,4-dichlorophenoxy)-N-(2,5-dimethylphenyl)butanamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-4-(2,4-dichlorophenoxy)-N-(2,5-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 19218656 |
| Molecular Formula | C24H22Cl3NO4S |
| Molecular Weight | 526.87 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-4-(2,4-dichlorophenoxy)-N-(2,5-dimethylphenyl)butanamide |
| SMILES | Cc1ccc(C)c(N(C(=O)CCCOc2ccc(Cl)cc2Cl)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H22Cl3NO4S/c1-16-5-6-17(2)22(14-16)28(33(30,31)20-10-7-18(25)8-11-20)24(29)4-3-13-32-23-12-9-19(26)15-21(23)27/h5-12,14-15H,3-4,13H2,1-2H3 |
| InChIKey | OAOOYGJRLGDSIA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.87 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|