C28H33NO4S — CID 19218787
N-(benzenesulfonyl)-4-(4-tert-butylphenoxy)-N-(4-ethylphenyl)butanamide (PubChem CID 19218787) has the molecular formula C28H33NO4S and a molecular weight of 479.64 g/mol. Its IUPAC name is N-(benzenesulfonyl)-4-(4-tert-butylphenoxy)-N-(4-ethylphenyl)butanamide.
| Compound Name | N-(benzenesulfonyl)-4-(4-tert-butylphenoxy)-N-(4-ethylphenyl)butanamide |
|---|---|
| PubChem CID | 19218787 |
| Molecular Formula | C28H33NO4S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-(benzenesulfonyl)-4-(4-tert-butylphenoxy)-N-(4-ethylphenyl)butanamide |
| SMILES | CCc1ccc(N(C(=O)CCCOc2ccc(C(C)(C)C)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33NO4S/c1-5-22-13-17-24(18-14-22)29(34(31,32)26-10-7-6-8-11-26)27(30)12-9-21-33-25-19-15-23(16-20-25)28(2,3)4/h6-8,10-11,13-20H,5,9,12,21H2,1-4H3 |
| InChIKey | PVXZOQFDMUGMLE-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|