C25H24BrNO5S — CID 19219589
(E)-N-(benzenesulfonyl)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide (PubChem CID 19219589) has the molecular formula C25H24BrNO5S and a molecular weight of 530.44 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19219589 |
| Molecular Formula | C25H24BrNO5S |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(c2cc(C)ccc2C)S(=O)(=O)c2ccccc2)cc(Br)c1OC |
| InChI | InChI=1S/C25H24BrNO5S/c1-17-10-11-18(2)22(14-17)27(33(29,30)20-8-6-5-7-9-20)24(28)13-12-19-15-21(26)25(32-4)23(16-19)31-3/h5-16H,1-4H3/b13-12+ |
| InChIKey | KVUVWZBQSIEEGY-OUKQBFOZSA-N |
| XLogP | 5.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|