C28H31NO5S — CID 19212013
(E)-N-(2,3-dimethylphenyl)-3-(3-methoxy-4-propoxyphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide (PubChem CID 19212013) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is (E)-N-(2,3-dimethylphenyl)-3-(3-methoxy-4-propoxyphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-N-(2,3-dimethylphenyl)-3-(3-methoxy-4-propoxyphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 19212013 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (E)-N-(2,3-dimethylphenyl)-3-(3-methoxy-4-propoxyphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)N(c2cccc(C)c2C)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C28H31NO5S/c1-6-18-34-26-16-12-23(19-27(26)33-5)13-17-28(30)29(25-9-7-8-21(3)22(25)4)35(31,32)24-14-10-20(2)11-15-24/h7-17,19H,6,18H2,1-5H3/b17-13+ |
| InChIKey | XNRZEAKATMIAET-GHRIWEEISA-N |
| XLogP | 5.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|