C23H20FNO3S — CID 19212274
(E)-N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 19212274) has the molecular formula C23H20FNO3S and a molecular weight of 409.48 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19212274 |
| Molecular Formula | C23H20FNO3S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | Cc1cccc(N(C(=O)/C=C/c2ccc(F)cc2)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C23H20FNO3S/c1-17-7-6-10-22(18(17)2)25(29(27,28)21-8-4-3-5-9-21)23(26)16-13-19-11-14-20(24)15-12-19/h3-16H,1-2H3/b16-13+ |
| InChIKey | CEFMMPBEVYZGBF-DTQAZKPQSA-N |
| XLogP | 4.88 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|