C21H18BrNO3S — CID 19210750
N-(benzenesulfonyl)-2-bromo-N-(2,3-dimethylphenyl)benzamide (PubChem CID 19210750) has the molecular formula C21H18BrNO3S and a molecular weight of 444.35 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-bromo-N-(2,3-dimethylphenyl)benzamide.
| Compound Name | N-(benzenesulfonyl)-2-bromo-N-(2,3-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 19210750 |
| Molecular Formula | C21H18BrNO3S |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | N-(benzenesulfonyl)-2-bromo-N-(2,3-dimethylphenyl)benzamide |
| SMILES | Cc1cccc(N(C(=O)c2ccccc2Br)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H18BrNO3S/c1-15-9-8-14-20(16(15)2)23(21(24)18-12-6-7-13-19(18)22)27(25,26)17-10-4-3-5-11-17/h3-14H,1-2H3 |
| InChIKey | CPSWMSWYLYWCOA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |