C22H20N2O5S — CID 19219288
N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-2-methyl-3-nitrobenzamide (PubChem CID 19219288) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-2-methyl-3-nitrobenzamide.
| Compound Name | N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 19219288 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-2-methyl-3-nitrobenzamide |
| SMILES | Cc1cccc(N(C(=O)c2cccc([N+](=O)[O-])c2C)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C22H20N2O5S/c1-15-9-7-13-20(16(15)2)23(30(28,29)18-10-5-4-6-11-18)22(25)19-12-8-14-21(17(19)3)24(26)27/h4-14H,1-3H3 |
| InChIKey | FLXSOWVVHUMHSE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|