C29H27NO3S — CID 19210212
N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-2-(2-phenylethyl)benzamide (PubChem CID 19210212) has the molecular formula C29H27NO3S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-2-(2-phenylethyl)benzamide.
| Compound Name | N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 19210212 |
| Molecular Formula | C29H27NO3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-2-(2-phenylethyl)benzamide |
| SMILES | Cc1cccc(N(C(=O)c2ccccc2CCc2ccccc2)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C29H27NO3S/c1-22-12-11-19-28(23(22)2)30(34(32,33)26-16-7-4-8-17-26)29(31)27-18-10-9-15-25(27)21-20-24-13-5-3-6-14-24/h3-19H,20-21H2,1-2H3 |
| InChIKey | BCRXOVTTYFLKPC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |