C30H27NO3S — CID 19212124
(E)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonyl-2,3-diphenylprop-2-enamide (PubChem CID 19212124) has the molecular formula C30H27NO3S and a molecular weight of 481.62 g/mol. Its IUPAC name is (E)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonyl-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonyl-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19212124 |
| Molecular Formula | C30H27NO3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (E)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonyl-2,3-diphenylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)/C(=C/c2ccccc2)c2ccccc2)c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C30H27NO3S/c1-22-17-19-27(20-18-22)35(33,34)31(29-16-10-11-23(2)24(29)3)30(32)28(26-14-8-5-9-15-26)21-25-12-6-4-7-13-25/h4-21H,1-3H3/b28-21+ |
| InChIKey | KOWVMCKMILYGSU-SGWCAAJKSA-N |
| XLogP | 6.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|