C24H21Cl2NO3S — CID 19211810
(E)-3-(2,4-dichlorophenyl)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide (PubChem CID 19211810) has the molecular formula C24H21Cl2NO3S and a molecular weight of 474.41 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 19211810 |
| Molecular Formula | C24H21Cl2NO3S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)/C=C/c2ccc(Cl)cc2Cl)c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C24H21Cl2NO3S/c1-16-7-12-21(13-8-16)31(29,30)27(23-6-4-5-17(2)18(23)3)24(28)14-10-19-9-11-20(25)15-22(19)26/h4-15H,1-3H3/b14-10+ |
| InChIKey | JXTIEUAYAQJBKH-GXDHUFHOSA-N |
| XLogP | 6.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|