C22H17Cl2NO3S — CID 19211796
(E)-N-(benzenesulfonyl)-3-(2,4-dichlorophenyl)-N-(4-methylphenyl)prop-2-enamide (PubChem CID 19211796) has the molecular formula C22H17Cl2NO3S and a molecular weight of 446.36 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-3-(2,4-dichlorophenyl)-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-3-(2,4-dichlorophenyl)-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19211796 |
| Molecular Formula | C22H17Cl2NO3S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-3-(2,4-dichlorophenyl)-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(N(C(=O)/C=C/c2ccc(Cl)cc2Cl)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17Cl2NO3S/c1-16-7-12-19(13-8-16)25(29(27,28)20-5-3-2-4-6-20)22(26)14-10-17-9-11-18(23)15-21(17)24/h2-15H,1H3/b14-10+ |
| InChIKey | AAVUYRXIAQKNFM-GXDHUFHOSA-N |
| XLogP | 5.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|