C23H20ClNO3S — CID 19211863
(E)-N-(benzenesulfonyl)-3-(4-chlorophenyl)-N-(4-ethylphenyl)prop-2-enamide (PubChem CID 19211863) has the molecular formula C23H20ClNO3S and a molecular weight of 425.94 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-3-(4-chlorophenyl)-N-(4-ethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-3-(4-chlorophenyl)-N-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19211863 |
| Molecular Formula | C23H20ClNO3S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-3-(4-chlorophenyl)-N-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(N(C(=O)/C=C/c2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20ClNO3S/c1-2-18-10-15-21(16-11-18)25(29(27,28)22-6-4-3-5-7-22)23(26)17-12-19-8-13-20(24)14-9-19/h3-17H,2H2,1H3/b17-12+ |
| InChIKey | RAWQCCGONIQVLU-SFQUDFHCSA-N |
| XLogP | 5.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|