C32H39NO5S — CID 19212082
(E)-N-(benzenesulfonyl)-N-(4-butylphenyl)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 19212082) has the molecular formula C32H39NO5S and a molecular weight of 549.73 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-N-(4-butylphenyl)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-N-(4-butylphenyl)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19212082 |
| Molecular Formula | C32H39NO5S |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-N-(4-butylphenyl)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)N(c2ccc(CCCC)cc2)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C32H39NO5S/c1-4-6-8-12-24-38-30-22-18-27(25-31(30)37-3)19-23-32(34)33(39(35,36)29-14-10-9-11-15-29)28-20-16-26(17-21-28)13-7-5-2/h9-11,14-23,25H,4-8,12-13,24H2,1-3H3/b23-19+ |
| InChIKey | XGMIBACOLRWDRB-FCDQGJHFSA-N |
| XLogP | 7.43 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|