C24H39NO3 — CID 19166248
(E)-3-(4-hexoxy-3-methoxyphenyl)-N,N-bis(2-methylpropyl)prop-2-enamide (PubChem CID 19166248) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is (E)-3-(4-hexoxy-3-methoxyphenyl)-N,N-bis(2-methylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(4-hexoxy-3-methoxyphenyl)-N,N-bis(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 19166248 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (E)-3-(4-hexoxy-3-methoxyphenyl)-N,N-bis(2-methylpropyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)N(CC(C)C)CC(C)C)cc1OC |
| InChI | InChI=1S/C24H39NO3/c1-7-8-9-10-15-28-22-13-11-21(16-23(22)27-6)12-14-24(26)25(17-19(2)3)18-20(4)5/h11-14,16,19-20H,7-10,15,17-18H2,1-6H3/b14-12+ |
| InChIKey | WWGYTZIYJLUTLJ-WYMLVPIESA-N |
| XLogP | 5.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|