C27H29NO6S — CID 19212409
(E)-N-(benzenesulfonyl)-3-(3,4-diethoxyphenyl)-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 19212409) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-3-(3,4-diethoxyphenyl)-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-3-(3,4-diethoxyphenyl)-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19212409 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-3-(3,4-diethoxyphenyl)-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(N(C(=O)/C=C/c2ccc(OCC)c(OCC)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO6S/c1-4-32-23-16-14-22(15-17-23)28(35(30,31)24-10-8-7-9-11-24)27(29)19-13-21-12-18-25(33-5-2)26(20-21)34-6-3/h7-20H,4-6H2,1-3H3/b19-13+ |
| InChIKey | YWTVALGNOHEYLZ-CPNJWEJPSA-N |
| XLogP | 5.32 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|