C23H19Cl2NO3S — CID 19211798
(E)-N-(benzenesulfonyl)-3-(2,4-dichlorophenyl)-N-(4-ethylphenyl)prop-2-enamide (PubChem CID 19211798) has the molecular formula C23H19Cl2NO3S and a molecular weight of 460.38 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-3-(2,4-dichlorophenyl)-N-(4-ethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-3-(2,4-dichlorophenyl)-N-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19211798 |
| Molecular Formula | C23H19Cl2NO3S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-3-(2,4-dichlorophenyl)-N-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(N(C(=O)/C=C/c2ccc(Cl)cc2Cl)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19Cl2NO3S/c1-2-17-8-13-20(14-9-17)26(30(28,29)21-6-4-3-5-7-21)23(27)15-11-18-10-12-19(24)16-22(18)25/h3-16H,2H2,1H3/b15-11+ |
| InChIKey | DTJCNHHBYQQAMJ-RVDMUPIBSA-N |
| XLogP | 5.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|