C20H25ClN2O4S — CID 110516295
4-chloro-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 110516295) has the molecular formula C20H25ClN2O4S and a molecular weight of 424.95 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110516295 |
| Molecular Formula | C20H25ClN2O4S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-chloro-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | CCCCCCOc1ccc(/C=N/NS(=O)(=O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C20H25ClN2O4S/c1-3-4-5-6-13-27-19-12-7-16(14-20(19)26-2)15-22-23-28(24,25)18-10-8-17(21)9-11-18/h7-12,14-15,23H,3-6,13H2,1-2H3/b22-15+ |
| InChIKey | RSMRYMVWWYUJTQ-PXLXIMEGSA-N |
| XLogP | 4.62 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|