C15H16BrNO4S2 — CID 110518635
(NZ)-N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]thiophene-2-sulfonamide (PubChem CID 110518635) has the molecular formula C15H16BrNO4S2 and a molecular weight of 418.33 g/mol. Its IUPAC name is (NZ)-N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]thiophene-2-sulfonamide.
| Compound Name | (NZ)-N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110518635 |
| Molecular Formula | C15H16BrNO4S2 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | (NZ)-N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]thiophene-2-sulfonamide |
| SMILES | COc1cc(/C=N\S(=O)(=O)c2cccs2)cc(Br)c1OC(C)C |
| InChI | InChI=1S/C15H16BrNO4S2/c1-10(2)21-15-12(16)7-11(8-13(15)20-3)9-17-23(18,19)14-5-4-6-22-14/h4-10H,1-3H3/b17-9- |
| InChIKey | FJVHJSGAOFBXOL-MFOYZWKCSA-N |
| XLogP | 4.11 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|