C14H14ClNO4S2 — CID 110518596
(NZ)-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylidene]thiophene-2-sulfonamide (PubChem CID 110518596) has the molecular formula C14H14ClNO4S2 and a molecular weight of 359.86 g/mol. Its IUPAC name is (NZ)-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylidene]thiophene-2-sulfonamide.
| Compound Name | (NZ)-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110518596 |
| Molecular Formula | C14H14ClNO4S2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | (NZ)-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylidene]thiophene-2-sulfonamide |
| SMILES | CCOc1c(Cl)cc(/C=N\S(=O)(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C14H14ClNO4S2/c1-3-20-14-11(15)7-10(8-12(14)19-2)9-16-22(17,18)13-5-4-6-21-13/h4-9H,3H2,1-2H3/b16-9- |
| InChIKey | FQAARDRQEXMVBN-SXGWCWSVSA-N |
| XLogP | 3.62 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|