C15H16N2O6S2 — CID 110518547
(NZ)-N-[(3-methoxy-5-nitro-4-propoxyphenyl)methylidene]thiophene-2-sulfonamide (PubChem CID 110518547) has the molecular formula C15H16N2O6S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is (NZ)-N-[(3-methoxy-5-nitro-4-propoxyphenyl)methylidene]thiophene-2-sulfonamide.
| Compound Name | (NZ)-N-[(3-methoxy-5-nitro-4-propoxyphenyl)methylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110518547 |
| Molecular Formula | C15H16N2O6S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (NZ)-N-[(3-methoxy-5-nitro-4-propoxyphenyl)methylidene]thiophene-2-sulfonamide |
| SMILES | CCCOc1c(OC)cc(/C=N\S(=O)(=O)c2cccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N2O6S2/c1-3-6-23-15-12(17(18)19)8-11(9-13(15)22-2)10-16-25(20,21)14-5-4-7-24-14/h4-5,7-10H,3,6H2,1-2H3/b16-10- |
| InChIKey | PGHOOSFPDWAUCK-YBEGLDIGSA-N |
| XLogP | 3.26 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|