C13H11Cl2NO3S2 — CID 110518583
(NZ)-N-[(3,5-dichloro-4-ethoxyphenyl)methylidene]thiophene-2-sulfonamide (PubChem CID 110518583) has the molecular formula C13H11Cl2NO3S2 and a molecular weight of 364.28 g/mol. Its IUPAC name is (NZ)-N-[(3,5-dichloro-4-ethoxyphenyl)methylidene]thiophene-2-sulfonamide.
| Compound Name | (NZ)-N-[(3,5-dichloro-4-ethoxyphenyl)methylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110518583 |
| Molecular Formula | C13H11Cl2NO3S2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | (NZ)-N-[(3,5-dichloro-4-ethoxyphenyl)methylidene]thiophene-2-sulfonamide |
| SMILES | CCOc1c(Cl)cc(/C=N\S(=O)(=O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C13H11Cl2NO3S2/c1-2-19-13-10(14)6-9(7-11(13)15)8-16-21(17,18)12-4-3-5-20-12/h3-8H,2H2,1H3/b16-8- |
| InChIKey | CJGDQOFVZLWPKW-PXNMLYILSA-N |
| XLogP | 4.26 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|