C13H12BrNO3S2 — CID 110518572
(NZ)-N-[(3-bromo-4-ethoxyphenyl)methylidene]thiophene-2-sulfonamide (PubChem CID 110518572) has the molecular formula C13H12BrNO3S2 and a molecular weight of 374.28 g/mol. Its IUPAC name is (NZ)-N-[(3-bromo-4-ethoxyphenyl)methylidene]thiophene-2-sulfonamide.
| Compound Name | (NZ)-N-[(3-bromo-4-ethoxyphenyl)methylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110518572 |
| Molecular Formula | C13H12BrNO3S2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | (NZ)-N-[(3-bromo-4-ethoxyphenyl)methylidene]thiophene-2-sulfonamide |
| SMILES | CCOc1ccc(/C=N\S(=O)(=O)c2cccs2)cc1Br |
| InChI | InChI=1S/C13H12BrNO3S2/c1-2-18-12-6-5-10(8-11(12)14)9-15-20(16,17)13-4-3-7-19-13/h3-9H,2H2,1H3/b15-9- |
| InChIKey | ZFOWYNLQOLRMAF-DHDCSXOGSA-N |
| XLogP | 3.72 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|