C17H18BrNO4 — CID 20985545
N-[[3-bromo-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]methylidene]hydroxylamine (PubChem CID 20985545) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is N-[[3-bromo-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]methylidene]hydroxylamine.
| Compound Name | N-[[3-bromo-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 20985545 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[[3-bromo-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]methylidene]hydroxylamine |
| SMILES | CCOc1ccccc1OCCOc1ccc(C=NO)cc1Br |
| InChI | InChI=1S/C17H18BrNO4/c1-2-21-16-5-3-4-6-17(16)23-10-9-22-15-8-7-13(12-19-20)11-14(15)18/h3-8,11-12,20H,2,9-10H2,1H3 |
| InChIKey | HOFVBTQYBWEBHI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|