C10H11NO4 — CID 4769996
2-ethoxy-5-(hydroxyiminomethyl)benzoic acid (PubChem CID 4769996) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 2-ethoxy-5-(hydroxyiminomethyl)benzoic acid.
| Compound Name | 2-ethoxy-5-(hydroxyiminomethyl)benzoic acid |
|---|---|
| PubChem CID | 4769996 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-ethoxy-5-(hydroxyiminomethyl)benzoic acid |
| SMILES | CCOc1ccc(C=NO)cc1C(=O)O |
| InChI | InChI=1S/C10H11NO4/c1-2-15-9-4-3-7(6-11-14)5-8(9)10(12)13/h3-6,14H,2H2,1H3,(H,12,13) |
| InChIKey | YIDYXWVFELOUKE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|