C20H21N3O5 — CID 8897558
5-[(Z)-[[2-(3,4-dimethylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxybenzoic acid (PubChem CID 8897558) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 5-[(Z)-[[2-(3,4-dimethylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxybenzoic acid.
| Compound Name | 5-[(Z)-[[2-(3,4-dimethylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxybenzoic acid |
|---|---|
| PubChem CID | 8897558 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 5-[(Z)-[[2-(3,4-dimethylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxybenzoic acid |
| SMILES | CCOc1ccc(/C=N\NC(=O)C(=O)Nc2ccc(C)c(C)c2)cc1C(=O)O |
| InChI | InChI=1S/C20H21N3O5/c1-4-28-17-8-6-14(10-16(17)20(26)27)11-21-23-19(25)18(24)22-15-7-5-12(2)13(3)9-15/h5-11H,4H2,1-3H3,(H,22,24)(H,23,25)(H,26,27)/b21-11- |
| InChIKey | AOYQSJZQWCEVRX-NHDPSOOVSA-N |
| XLogP | 2.49 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|