C25H30N4O5 — CID 126182097
N-(3,4-dimethylphenyl)-N'-[(Z)-[3-ethoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide (PubChem CID 126182097) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N'-[(Z)-[3-ethoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide.
| Compound Name | N-(3,4-dimethylphenyl)-N'-[(Z)-[3-ethoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126182097 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N'-[(Z)-[3-ethoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)Nc2ccc(C)c(C)c2)ccc1OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C25H30N4O5/c1-4-33-22-14-19(8-10-21(22)34-16-23(30)29-11-5-6-12-29)15-26-28-25(32)24(31)27-20-9-7-17(2)18(3)13-20/h7-10,13-15H,4-6,11-12,16H2,1-3H3,(H,27,31)(H,28,32)/b26-15- |
| InChIKey | VHPNSUBUYUYNFP-YSMPRRRNSA-N |
| XLogP | 2.79 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|