C22H23ClN4O5 — CID 126266479
N-(3-chlorophenyl)-N'-[(Z)-[3-methoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide (PubChem CID 126266479) has the molecular formula C22H23ClN4O5 and a molecular weight of 458.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-[(Z)-[3-methoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide.
| Compound Name | N-(3-chlorophenyl)-N'-[(Z)-[3-methoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126266479 |
| Molecular Formula | C22H23ClN4O5 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-(3-chlorophenyl)-N'-[(Z)-[3-methoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)Nc2cccc(Cl)c2)ccc1OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H23ClN4O5/c1-31-19-11-15(7-8-18(19)32-14-20(28)27-9-2-3-10-27)13-24-26-22(30)21(29)25-17-6-4-5-16(23)12-17/h4-8,11-13H,2-3,9-10,14H2,1H3,(H,25,29)(H,26,30)/b24-13- |
| InChIKey | OHZIAQSSKXKLEU-CFRMEGHHSA-N |
| XLogP | 2.44 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|