C16H16BrNO3 — CID 20993090
N-[[3-bromo-4-[2-(3-methylphenoxy)ethoxy]phenyl]methylidene]hydroxylamine (PubChem CID 20993090) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is N-[[3-bromo-4-[2-(3-methylphenoxy)ethoxy]phenyl]methylidene]hydroxylamine.
| Compound Name | N-[[3-bromo-4-[2-(3-methylphenoxy)ethoxy]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 20993090 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[[3-bromo-4-[2-(3-methylphenoxy)ethoxy]phenyl]methylidene]hydroxylamine |
| SMILES | Cc1cccc(OCCOc2ccc(C=NO)cc2Br)c1 |
| InChI | InChI=1S/C16H16BrNO3/c1-12-3-2-4-14(9-12)20-7-8-21-16-6-5-13(11-18-19)10-15(16)17/h2-6,9-11,19H,7-8H2,1H3 |
| InChIKey | QEGLGIVPNCNNIJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|